![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Kocakpaper[1].pdf | 2007-06-15 12:01 | 582K | |
| Witkin Scale Space FIltering.pdf | 2006-07-05 11:08 | 727K | |
| mikolajczyk_ijcv2004.pdf | 2006-06-28 11:41 | 1.2M | |
| Koenderink Structure of Images.pdf | 2006-07-05 16:56 | 1.2M | |
| Koenderink Representation of Local Geometry in the Visual System.pdf | 2006-07-05 16:53 | 1.3M | |
| A_Combined_Corner_and_Edge_Detector.pdf | 2006-06-15 16:50 | 1.6M | |
| DeAngelisGCetal Neuro.pdf | 2006-06-27 10:35 | 3.9M | |