![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 2009 molecular Sequences/ | 2019-02-06 07:04 | - | |
| 2011-2012 Erynn and Brandon/ | 2013-12-31 09:01 | - | |
| 2018 Kuhnz/ | 2024-10-21 13:29 | - | |
| A year in the life/ | 2020-03-25 18:49 | - | |
| Camera Sled data from Ruhl/ | 2016-03-25 12:15 | - | |
| Data to Monique for analysis/ | 2020-02-05 11:41 | - | |
| Interns/ | 2013-12-31 14:53 | - | |
| Kuhnz ROV Data and megafaunal publication 2014/ | 2024-10-21 13:28 | - | |
| Modeling transect subsbset 2012/ | 2015-02-26 10:24 | - | |
| Time Lapse movies/ | 2019-02-06 07:04 | - | |
| pictures/ | 2015-07-09 11:40 | - | |
| Benthocodon ROV pulses 2006-2018.xlsx | 2019-04-29 10:42 | 13K | |
| Station M analysis status.xlsx | 2019-08-06 07:29 | 23K | |
| StationMtaxaNov2018.xlsx | 2018-11-08 09:22 | 30K | |
| How to combine ROV and camsled data.xlsx | 2016-03-25 15:28 | 46K | |
| ROV transect procedure.docx | 2014-10-08 15:24 | 82K | |
| Thumbs.db | 2019-04-29 09:45 | 273K | |
| StationMsizingMAIN.xlsx | 2015-07-06 11:17 | 14M | |